Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
2,4,6-Collidine, 99%
CAS: 108-75-8 Molecular Formula: C8H11N Molecular Weight (g/mol): 121.18 MDL Number: MFCD00006338 InChI Key: BWZVCCNYKMEVEX-UHFFFAOYSA-N Synonym: 2,4,6-collidine,gamma-collidine,s-collidine,pyridine, 2,4,6-trimethyl,collidine,sym-collidine,2,4,6-kollidin,unii-7ie4bk5j5v,2,4,6-trimethyl-pyridine,.gamma.-collidine PubChem CID: 7953 IUPAC Name: 2,4,6-trimethylpyridine SMILES: CC1=CC(C)=NC(C)=C1
| PubChem CID | 7953 |
|---|---|
| CAS | 108-75-8 |
| Molecular Weight (g/mol) | 121.18 |
| MDL Number | MFCD00006338 |
| SMILES | CC1=CC(C)=NC(C)=C1 |
| Synonym | 2,4,6-collidine,gamma-collidine,s-collidine,pyridine, 2,4,6-trimethyl,collidine,sym-collidine,2,4,6-kollidin,unii-7ie4bk5j5v,2,4,6-trimethyl-pyridine,.gamma.-collidine |
| IUPAC Name | 2,4,6-trimethylpyridine |
| InChI Key | BWZVCCNYKMEVEX-UHFFFAOYSA-N |
| Molecular Formula | C8H11N |
p-Toluenesulfonic acid monohydrate, 97.5%, pure
CAS: 6192-52-5 MDL Number: MFCD00142137 InChI Key: KJIFKLIQANRMOU-UHFFFAOYSA-N Synonym: p-toluenesulfonic acid monohydrate,4-methylbenzenesulfonic acid hydrate,4-methylbenzenesulfonic acid monohydrate,p-toluene sulfonic acid monohydrate,unii-3bto78gaff,benzenesulfonic acid, 4-methyl-, monohydrate,ptoluenesulfonic acid,p-toluenesulfonic acid, monohydrate,3bto78gaff,4-methylbenzene-1-sulfonic acid hydrate PubChem CID: 521998 IUPAC Name: 4-methylbenzenesulfonic acid;hydrate SMILES: CC1=CC=C(C=C1)S(=O)(=O)O.O
| PubChem CID | 521998 |
|---|---|
| CAS | 6192-52-5 |
| MDL Number | MFCD00142137 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.O |
| Synonym | p-toluenesulfonic acid monohydrate,4-methylbenzenesulfonic acid hydrate,4-methylbenzenesulfonic acid monohydrate,p-toluene sulfonic acid monohydrate,unii-3bto78gaff,benzenesulfonic acid, 4-methyl-, monohydrate,ptoluenesulfonic acid,p-toluenesulfonic acid, monohydrate,3bto78gaff,4-methylbenzene-1-sulfonic acid hydrate |
| IUPAC Name | 4-methylbenzenesulfonic acid;hydrate |
| InChI Key | KJIFKLIQANRMOU-UHFFFAOYSA-N |
4-Hydroxybenzeneboronic acid, 97%
CAS: 71597-85-8 Molecular Formula: C6H7BO3 Molecular Weight (g/mol): 137.93 MDL Number: MFCD01074628 InChI Key: COIQUVGFTILYGA-UHFFFAOYSA-N Synonym: 4-hydroxyphenyl boronic acid,4-hydroxybenzeneboronic acid,4-boronophenol,4-hydroxyphenyl boranediol,p-hydroxyphenylboronic acid,4-hydroxyphenyl-boronic acid,boronic acid, 4-hydroxyphenyl,pubchem1729,acmc-209ojb PubChem CID: 2734360 IUPAC Name: (4-hydroxyphenyl)boronic acid SMILES: OB(O)C1=CC=C(O)C=C1
| PubChem CID | 2734360 |
|---|---|
| CAS | 71597-85-8 |
| Molecular Weight (g/mol) | 137.93 |
| MDL Number | MFCD01074628 |
| SMILES | OB(O)C1=CC=C(O)C=C1 |
| Synonym | 4-hydroxyphenyl boronic acid,4-hydroxybenzeneboronic acid,4-boronophenol,4-hydroxyphenyl boranediol,p-hydroxyphenylboronic acid,4-hydroxyphenyl-boronic acid,boronic acid, 4-hydroxyphenyl,pubchem1729,acmc-209ojb |
| IUPAC Name | (4-hydroxyphenyl)boronic acid |
| InChI Key | COIQUVGFTILYGA-UHFFFAOYSA-N |
| Molecular Formula | C6H7BO3 |
Acetoxyacetyl chloride, 97%
CAS: 13831-31-7 Molecular Formula: C4H5ClO3 Molecular Weight (g/mol): 136.53 MDL Number: MFCD00011535 InChI Key: HZDNNJABYXNPPV-UHFFFAOYSA-N Synonym: acetoxyacetyl chloride,2-acetoxyacetyl chloride,unii-z4s19y2f8s,acetoxyacetylchloride,acetyl chloride, acetyloxy,acetoxyacetic acid chloride,chlorocarbonyl methyl acetate,acetoxy acetylchloride,acetyloxyacetyl chloride,pubchem20920 PubChem CID: 26297 IUPAC Name: (2-chloro-2-oxoethyl) acetate SMILES: CC(=O)OCC(=O)Cl
| PubChem CID | 26297 |
|---|---|
| CAS | 13831-31-7 |
| Molecular Weight (g/mol) | 136.53 |
| MDL Number | MFCD00011535 |
| SMILES | CC(=O)OCC(=O)Cl |
| Synonym | acetoxyacetyl chloride,2-acetoxyacetyl chloride,unii-z4s19y2f8s,acetoxyacetylchloride,acetyl chloride, acetyloxy,acetoxyacetic acid chloride,chlorocarbonyl methyl acetate,acetoxy acetylchloride,acetyloxyacetyl chloride,pubchem20920 |
| IUPAC Name | (2-chloro-2-oxoethyl) acetate |
| InChI Key | HZDNNJABYXNPPV-UHFFFAOYSA-N |
| Molecular Formula | C4H5ClO3 |
1-(3-Dimethylaminopropyl)-3-ethylcarbodiimide, 97%
CAS: 1892-57-5 Molecular Formula: C8H17N3 Molecular Weight (g/mol): 155.24 InChI Key: LMDZBCPBFSXMTL-UHFFFAOYSA-N Synonym: 1-3-dimethylaminopropyl-3-ethylcarbodiimide,edac,1-ethyl-3-3-dimethylaminopropyl carbodiimide,n1-ethylimino methylene-n3,n3-dimethylpropane-1,3-diamine,unii-rj5ozg6i4a,edci,1,3-propanediamine, n'-ethylcarbonimidoyl-n,n-dimethyl,n-3-dimethylaminopropyl-n'-ethylcarbodiimide,rj5ozg6i4a,ethyldimethylaminopropyl carbodiimide PubChem CID: 15908 IUPAC Name: 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine SMILES: CCN=C=NCCCN(C)C
| PubChem CID | 15908 |
|---|---|
| CAS | 1892-57-5 |
| Molecular Weight (g/mol) | 155.24 |
| SMILES | CCN=C=NCCCN(C)C |
| Synonym | 1-3-dimethylaminopropyl-3-ethylcarbodiimide,edac,1-ethyl-3-3-dimethylaminopropyl carbodiimide,n1-ethylimino methylene-n3,n3-dimethylpropane-1,3-diamine,unii-rj5ozg6i4a,edci,1,3-propanediamine, n'-ethylcarbonimidoyl-n,n-dimethyl,n-3-dimethylaminopropyl-n'-ethylcarbodiimide,rj5ozg6i4a,ethyldimethylaminopropyl carbodiimide |
| IUPAC Name | 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine |
| InChI Key | LMDZBCPBFSXMTL-UHFFFAOYSA-N |
| Molecular Formula | C8H17N3 |
Trifluoromethanesulfonic acid, 99%, extra pure
CAS: 1493-13-6 Molecular Formula: CHF3O3S Molecular Weight (g/mol): 150.07 MDL Number: MFCD00007514 InChI Key: ITMCEJHCFYSIIV-UHFFFAOYSA-N Synonym: trifluoromethanesulphonic acid,trimsylate,methanesulfonic acid, trifluoro,triflic acid,trifluoromethylsulfonic acid,perfluoromethanesulfonic acid,tfoh,trifluoromethane sulfonic acid,tfmsa,hotf PubChem CID: 62406 ChEBI: CHEBI:48511 SMILES: OS(=O)(=O)C(F)(F)F
| PubChem CID | 62406 |
|---|---|
| CAS | 1493-13-6 |
| Molecular Weight (g/mol) | 150.07 |
| ChEBI | CHEBI:48511 |
| MDL Number | MFCD00007514 |
| SMILES | OS(=O)(=O)C(F)(F)F |
| Synonym | trifluoromethanesulphonic acid,trimsylate,methanesulfonic acid, trifluoro,triflic acid,trifluoromethylsulfonic acid,perfluoromethanesulfonic acid,tfoh,trifluoromethane sulfonic acid,tfmsa,hotf |
| InChI Key | ITMCEJHCFYSIIV-UHFFFAOYSA-N |
| Molecular Formula | CHF3O3S |
Polyoxyethylene bis(amine), M.W. 1,000
CAS: 24991-53-5 Molecular Formula: H2NCH2CH2(OCH2CH2)nNH2 MDL Number: MFCD00132004 Synonym: PEG-diamine
| CAS | 24991-53-5 |
|---|---|
| MDL Number | MFCD00132004 |
| Synonym | PEG-diamine |
| Molecular Formula | H2NCH2CH2(OCH2CH2)nNH2 |
Isophorone diisocyanate, mixture of isomers, 98%
CAS: 4098-71-9 Molecular Formula: C12H18N2O2 Molecular Weight (g/mol): 222.29 MDL Number: MFCD00064956 InChI Key: NIMLQBUJDJZYEJ-UHFFFAOYNA-N Synonym: isophorone diisocyanate,ipdi,isophorone diamine diisocyanate,5-isocyanato-1-isocyanatomethyl-1,3,3-trimethylcyclohexane,3-isocyanatomethyl-3,5,5-trimethylcyclohexylisocyanate,cyclohexane, 5-isocyanato-1-isocyanatomethyl-1,3,3-trimethyl,3-isocyanatomethyl-3,5,5-trimethylcyclohexyl isocyanate,ccris 6252,isocyanic acid, methylene 3,5,5-trimethyl-3,1-cyclohexylene ester,isophorone diisocyanate diisocyanates PubChem CID: 169132 ChEBI: CHEBI:53214 IUPAC Name: 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane SMILES: CC1(C)CC(CC(C)(CN=C=O)C1)N=C=O
| PubChem CID | 169132 |
|---|---|
| CAS | 4098-71-9 |
| Molecular Weight (g/mol) | 222.29 |
| ChEBI | CHEBI:53214 |
| MDL Number | MFCD00064956 |
| SMILES | CC1(C)CC(CC(C)(CN=C=O)C1)N=C=O |
| Synonym | isophorone diisocyanate,ipdi,isophorone diamine diisocyanate,5-isocyanato-1-isocyanatomethyl-1,3,3-trimethylcyclohexane,3-isocyanatomethyl-3,5,5-trimethylcyclohexylisocyanate,cyclohexane, 5-isocyanato-1-isocyanatomethyl-1,3,3-trimethyl,3-isocyanatomethyl-3,5,5-trimethylcyclohexyl isocyanate,ccris 6252,isocyanic acid, methylene 3,5,5-trimethyl-3,1-cyclohexylene ester,isophorone diisocyanate diisocyanates |
| IUPAC Name | 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane |
| InChI Key | NIMLQBUJDJZYEJ-UHFFFAOYNA-N |
| Molecular Formula | C12H18N2O2 |
1-Chlorobutane, MilliporeSigma™
CAS: 109-69-3 Molecular Formula: C4H9Cl Molecular Weight (g/mol): 92.57 MDL Number: MFCD00001009 InChI Key: VFWCMGCRMGJXDK-UHFFFAOYSA-N Synonym: butyl chloride,n-butyl chloride,butane, 1-chloro,chlorure de butyle,nbc wormer,n-propylcarbinyl chloride,sure shot,butane, chloro,chlorobutane,n-chlorobutane PubChem CID: 8005 IUPAC Name: 1-chlorobutane SMILES: CCCCCl
| PubChem CID | 8005 |
|---|---|
| CAS | 109-69-3 |
| Molecular Weight (g/mol) | 92.57 |
| MDL Number | MFCD00001009 |
| SMILES | CCCCCl |
| Synonym | butyl chloride,n-butyl chloride,butane, 1-chloro,chlorure de butyle,nbc wormer,n-propylcarbinyl chloride,sure shot,butane, chloro,chlorobutane,n-chlorobutane |
| IUPAC Name | 1-chlorobutane |
| InChI Key | VFWCMGCRMGJXDK-UHFFFAOYSA-N |
| Molecular Formula | C4H9Cl |
DL-3-Hydroxybutyric acid, sodium salt, 99%
CAS: 150-83-4 Molecular Formula: C4H7NaO3 Molecular Weight (g/mol): 126.09 MDL Number: MFCD00016716 InChI Key: NBPUSGBJDWCHKC-UHFFFAOYSA-M Synonym: sodium 3-hydroxybutyrate,sodium 3-hydroxybutanoate,dl-3-hydroxybutyric acid sodium salt,sodium beta-hydroxybutyrate,butanoic acid, 3-hydroxy-, monosodium salt,butanoic acid,3-hydroxy-, sodium salt 1:1,dl-3-hydroxybutyric acid, sodium salt,3-hydroxybutyric acid sodium salt,sodium 3-oxidanylbutanoate,dl-beta-hydroxybutyric acid sodium salt PubChem CID: 23676771 IUPAC Name: sodium;3-hydroxybutanoate SMILES: CC(CC(=O)[O-])O.[Na+]
| PubChem CID | 23676771 |
|---|---|
| CAS | 150-83-4 |
| Molecular Weight (g/mol) | 126.09 |
| MDL Number | MFCD00016716 |
| SMILES | CC(CC(=O)[O-])O.[Na+] |
| Synonym | sodium 3-hydroxybutyrate,sodium 3-hydroxybutanoate,dl-3-hydroxybutyric acid sodium salt,sodium beta-hydroxybutyrate,butanoic acid, 3-hydroxy-, monosodium salt,butanoic acid,3-hydroxy-, sodium salt 1:1,dl-3-hydroxybutyric acid, sodium salt,3-hydroxybutyric acid sodium salt,sodium 3-oxidanylbutanoate,dl-beta-hydroxybutyric acid sodium salt |
| IUPAC Name | sodium;3-hydroxybutanoate |
| InChI Key | NBPUSGBJDWCHKC-UHFFFAOYSA-M |
| Molecular Formula | C4H7NaO3 |
Cumyl hydroperoxide, tech. 80%
CAS: 80-15-9 Molecular Formula: C9H12O2 Molecular Weight (g/mol): 152.19 MDL Number: MFCD00002129 InChI Key: YQHLDYVWEZKEOX-UHFFFAOYSA-N Synonym: cumene hydroperoxide,cumyl hydroperoxide,hydroperoxide, 1-methyl-1-phenylethyl,cumenyl hydroperoxide,alpha,alpha-dimethylbenzyl hydroperoxide,cumolhydroperoxid,7-cumyl hydroperoxide,cumolhydroperoxide,cument hydroperoxide,hydroperoxyde de cumene PubChem CID: 6629 ChEBI: CHEBI:78673 IUPAC Name: 2-hydroperoxypropan-2-ylbenzene SMILES: CC(C)(OO)C1=CC=CC=C1
| PubChem CID | 6629 |
|---|---|
| CAS | 80-15-9 |
| Molecular Weight (g/mol) | 152.19 |
| ChEBI | CHEBI:78673 |
| MDL Number | MFCD00002129 |
| SMILES | CC(C)(OO)C1=CC=CC=C1 |
| Synonym | cumene hydroperoxide,cumyl hydroperoxide,hydroperoxide, 1-methyl-1-phenylethyl,cumenyl hydroperoxide,alpha,alpha-dimethylbenzyl hydroperoxide,cumolhydroperoxid,7-cumyl hydroperoxide,cumolhydroperoxide,cument hydroperoxide,hydroperoxyde de cumene |
| IUPAC Name | 2-hydroperoxypropan-2-ylbenzene |
| InChI Key | YQHLDYVWEZKEOX-UHFFFAOYSA-N |
| Molecular Formula | C9H12O2 |
Isopropylamine 99.0+%, TCI America™
CAS: 75-31-0 Molecular Formula: C3H9N Molecular Weight (g/mol): 59.112 MDL Number: MFCD00008082 InChI Key: JJWLVOIRVHMVIS-UHFFFAOYSA-N Synonym: isopropylamine,2-propanamine,2-aminopropane,monoisopropylamine,2-propylamine,sec-propylamine,1-methylethylamine,isopropyl amine,isopropilamina,propane, 2-amino PubChem CID: 6363 ChEBI: CHEBI:15739 IUPAC Name: propan-2-amine SMILES: CC(C)N
| PubChem CID | 6363 |
|---|---|
| CAS | 75-31-0 |
| Molecular Weight (g/mol) | 59.112 |
| ChEBI | CHEBI:15739 |
| MDL Number | MFCD00008082 |
| SMILES | CC(C)N |
| Synonym | isopropylamine,2-propanamine,2-aminopropane,monoisopropylamine,2-propylamine,sec-propylamine,1-methylethylamine,isopropyl amine,isopropilamina,propane, 2-amino |
| IUPAC Name | propan-2-amine |
| InChI Key | JJWLVOIRVHMVIS-UHFFFAOYSA-N |
| Molecular Formula | C3H9N |
Pyrene, 98%
CAS: 129-00-0 Molecular Formula: C16H10 Molecular Weight (g/mol): 202.25 MDL Number: MFCD00004136 InChI Key: BBEAQIROQSPTKN-UHFFFAOYSA-N Synonym: benzo def phenanthrene,pyren,beta-pyrene,.beta.-pyrene,pyren german,unii-9e0t7wfw93,ccris 1256,pyrene def phenanthrene,coal tar pitch volatiles:pyrene PubChem CID: 31423 ChEBI: CHEBI:39106 IUPAC Name: pyrene SMILES: C1=CC2=C3C(=C1)C=CC4=CC=CC(=C43)C=C2
| PubChem CID | 31423 |
|---|---|
| CAS | 129-00-0 |
| Molecular Weight (g/mol) | 202.25 |
| ChEBI | CHEBI:39106 |
| MDL Number | MFCD00004136 |
| SMILES | C1=CC2=C3C(=C1)C=CC4=CC=CC(=C43)C=C2 |
| Synonym | benzo def phenanthrene,pyren,beta-pyrene,.beta.-pyrene,pyren german,unii-9e0t7wfw93,ccris 1256,pyrene def phenanthrene,coal tar pitch volatiles:pyrene |
| IUPAC Name | pyrene |
| InChI Key | BBEAQIROQSPTKN-UHFFFAOYSA-N |
| Molecular Formula | C16H10 |
Tris(2-aminoethyl)amine, 98+%
CAS: 4097-89-6 Molecular Formula: C6H18N4 Molecular Weight (g/mol): 146.24 InChI Key: MBYLVOKEDDQJDY-UHFFFAOYSA-N Synonym: tris 2-aminoethyl amine,tren,taea,2,2',2-triaminotriethylamine,1,2-ethanediamine, n,n-bis 2-aminoethyl,tri 2-aminoethyl amine,tren hp,tris aminoethyl amine,nitrilotris ethylamine,n,n-bis 2-aminoethyl ethane-1,2-diamine PubChem CID: 77731 ChEBI: CHEBI:30631 IUPAC Name: N',N'-bis(2-aminoethyl)ethane-1,2-diamine SMILES: C(CN(CCN)CCN)N
| PubChem CID | 77731 |
|---|---|
| CAS | 4097-89-6 |
| Molecular Weight (g/mol) | 146.24 |
| ChEBI | CHEBI:30631 |
| SMILES | C(CN(CCN)CCN)N |
| Synonym | tris 2-aminoethyl amine,tren,taea,2,2',2-triaminotriethylamine,1,2-ethanediamine, n,n-bis 2-aminoethyl,tri 2-aminoethyl amine,tren hp,tris aminoethyl amine,nitrilotris ethylamine,n,n-bis 2-aminoethyl ethane-1,2-diamine |
| IUPAC Name | N',N'-bis(2-aminoethyl)ethane-1,2-diamine |
| InChI Key | MBYLVOKEDDQJDY-UHFFFAOYSA-N |
| Molecular Formula | C6H18N4 |